WKYMVM TFA
Modify Date: 2025-10-07 11:23:37
WKYMVM TFA structure
|
Common Name | WKYMVM TFA | ||
|---|---|---|---|---|
| CAS Number | 1313730-09-4 | Molecular Weight | 970.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H62F3N9O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WKYMVM TFAWKYMVM (TFA) is a potent N-formyl peptide receptor (FPR1) and FPRL1/2 agonist, also activates several leukocyte effector functions such as chemotaxis, mobilization of complement receptor-3, and activation of the NADPH oxidase[1][2]. |
| Name | WKYMVM TFA |
|---|
| Description | WKYMVM (TFA) is a potent N-formyl peptide receptor (FPR1) and FPRL1/2 agonist, also activates several leukocyte effector functions such as chemotaxis, mobilization of complement receptor-3, and activation of the NADPH oxidase[1][2]. |
|---|---|
| Related Catalog | |
| Target |
FPR1, FPRL1[1], FPRL2[2] |
| References |
| Molecular Formula | C43H62F3N9O9S2 |
|---|---|
| Molecular Weight | 970.13 |
| InChIKey | MYVYQWVNXDVTBW-HQORXVKSSA-N |
| SMILES | CSCCC(NC(=O)C(NC(=O)C(CCSC)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)C)C(N)=O.O=C(O)C(F)(F)F |