WKYMVm structure
|
Common Name | WKYMVm | ||
|---|---|---|---|---|
| CAS Number | 187986-17-0 | Molecular Weight | 856.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H61N9O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WKYMVmWKYMVM is a potent N-formyl peptide receptor (FPR1) and FPRL1/2 agonist, also activates several leukocyte effector functions such as chemotaxis, mobilization of complement receptor-3, and activation of the NADPH oxidase[1][2]. |
| Name | Trp-Lys-Tyr-Met-Val-D-Met |
|---|---|
| Synonym | More Synonyms |
| Description | WKYMVM is a potent N-formyl peptide receptor (FPR1) and FPRL1/2 agonist, also activates several leukocyte effector functions such as chemotaxis, mobilization of complement receptor-3, and activation of the NADPH oxidase[1][2]. |
|---|---|
| Related Catalog | |
| Target |
FPR1, FPRL1[1], FPRL2[2] |
| References |
| Molecular Formula | C41H61N9O7S2 |
|---|---|
| Molecular Weight | 856.11 |
| Exact Mass | 856.39800 |
| PSA | 321.46000 |
| LogP | 5.14090 |
| InChIKey | FMBGOORJEKQQLG-JUZZZACGSA-N |
| SMILES | CSCCC(NC(=O)C(NC(=O)C(CCSC)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)C)C(N)=O |
| M.W. 856.11 C41H61N9O7S2 |
| H-TRP-LYS-TYR-MET-VAL-D-MET-NH2 TRIFLUOROACETATE |
| WKYMVMaMide,W-Peptide |
| H-Ala-Val-Thr-Tyr-Ser-Arg-Ser-Arg-Tyr-Leu-Glu-Cys-OH |
| Tryptophanyl-lysinyl-tyrosinyl-methionyl-valinyl-D-methionine |
| WKYMVMAMIDE TRIFLUOROACETATE |