Orexin receptor antagonist 3
Modify Date: 2025-08-26 11:37:53
Orexin receptor antagonist 3 structure
|
Common Name | Orexin receptor antagonist 3 | ||
|---|---|---|---|---|
| CAS Number | 1293282-55-9 | Molecular Weight | 434.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Orexin receptor antagonist 3Orexin receptor antagonist 3 (example 216) is an orexin receptor antagonist, which is extracted from the patent WO2011050198A1. |
| Name | Orexin receptor antagonist 3 |
|---|
| Description | Orexin receptor antagonist 3 (example 216) is an orexin receptor antagonist, which is extracted from the patent WO2011050198A1. |
|---|
| Molecular Formula | C21H22N8O3 |
|---|---|
| Molecular Weight | 434.45 |
| InChIKey | MPDQVXKSEUGRGO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4c(-n5nccn5)cccc4[N+](=O)[O-])CC3C2)n1 |