MK-8931 structure
|
Common Name | MK-8931 | ||
|---|---|---|---|---|
| CAS Number | 1286770-55-5 | Molecular Weight | 409.410 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17F2N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK-8931Verubecestat (MK-8931) is a beta-secretase 1 (BACE1) inhibitor under investigation for the treatment of Alzheimer's Disease. |
| Name | Verubecestat |
|---|---|
| Synonym | More Synonyms |
| Description | Verubecestat (MK-8931) is a beta-secretase 1 (BACE1) inhibitor under investigation for the treatment of Alzheimer's Disease. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H17F2N5O3S |
| Molecular Weight | 409.410 |
| Exact Mass | 409.102020 |
| PSA | 126.13000 |
| LogP | -0.56 |
| Index of Refraction | 1.655 |
| InChIKey | YHYKUSGACIYRML-KRWDZBQOSA-N |
| SMILES | CN1C(N)=NC(C)(c2cc(NC(=O)c3ccc(F)cn3)ccc2F)CS1(=O)=O |
| Storage condition | -20℃ |
| UNII-J1I0P6WT7T |
| MK-8931-009 |
| N-{3-[(5R)-3-Amino-2,5-dimethyl-1,1-dioxido-5,6-dihydro-2H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl}-5-fluoro-2-pyridinecarboxamide |
| N-{3-[(5R)-3-amino-2,5-diméthyl-1,1-dioxo-1,2,5,6- tétrahydro-1λ6,2,4-thiadiazin-5-yl]-4-fluorophényl}- 5-fluoropyridine-2-carboxamide |
| (R)-N-(3-(3-amino-2,5-dimethyl-1,1-dioxido-5,6-dihydro-2H-1,2,4-thiadiazin-5-yl)-4-fluorophenyl)-5-fluoropicolinamide |
| Verubecestat |
| MK8931 |
| 2-Pyridinecarboxamide, N-[3-[(5R)-3-amino-5,6-dihydro-2,5-dimethyl-1,1-dioxido-2H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-5-fluoro- |