GRN-529
Modify Date: 2024-08-26 18:02:37
GRN-529 structure
|
Common Name | GRN-529 | ||
|---|---|---|---|---|
| CAS Number | 1253291-12-1 | Molecular Weight | 391.370 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 620.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H15F2N3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 329.3±31.5 °C | |
Use of GRN-529A highly potent, selective, orally active mGluR5 negative allosteric modulator with Ki of 5.4 nM, IC50 of 3.1 nM. |
| Name | GRN-529 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 620.9±55.0 °C at 760 mmHg |
| Molecular Formula | C22H15F2N3O2 |
| Molecular Weight | 391.370 |
| Flash Point | 329.3±31.5 °C |
| Exact Mass | 391.113220 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | JITMSIRHBAVREW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(OC(F)F)c(C#Cc2ccccn2)c1)N1Cc2cccnc2C1 |
| RIDADR | NONH for all modes of transport |
|---|
| [4-(Difluoromethoxy)-3-(2-pyridinylethynyl)phenyl](5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methanone |
| Methanone, [4-(difluoromethoxy)-3-[2-(2-pyridinyl)ethynyl]phenyl](5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)- |
| (4-(difluoromethoxy)-3-(pyridin-2-ylethynyl)phenyl)(5H-pyrrolo[3,4-b]pyridin-6(7H)-yl)methanone |
| GRN-529 |