MAO-IN-1
Modify Date: 2025-08-25 18:22:06
MAO-IN-1 structure
|
Common Name | MAO-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 124991-40-8 | Molecular Weight | 322.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MAO-IN-1MAO-IN-1 is a monoamine oxidase B (MAO B) inhibitor with an IC50 of 20 nM. |
| Name | MAO-IN-1 |
|---|
| Description | MAO-IN-1 is a monoamine oxidase B (MAO B) inhibitor with an IC50 of 20 nM. |
|---|---|
| Related Catalog | |
| Target |
IC50: 20 nM (MAO B)[1] |
| References |
| Molecular Formula | C17H19ClO4 |
|---|---|
| Molecular Weight | 322.78 |
| InChIKey | OTDRIRFHGNXOBO-HNNXBMFYSA-N |
| SMILES | COCC(O)COc1ccc(OCc2cccc(Cl)c2)cc1 |