N-Boc-D-tert-leucine structure
|
Common Name | N-Boc-D-tert-leucine | ||
|---|---|---|---|---|
| CAS Number | 124655-17-0 | Molecular Weight | 231.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 350.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | 118-121ºC | |
| MSDS | N/A | Flash Point | 165.5±23.2 °C | |
Use of N-Boc-D-tert-leucineBoc-D-tert-leucine is a leucine derivative[1]. |
| Name | (2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-D-tert-leucine is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.0±25.0 °C at 760 mmHg |
| Melting Point | 118-121ºC |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.289 |
| Flash Point | 165.5±23.2 °C |
| Exact Mass | 231.147064 |
| PSA | 75.63000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | LRFZIPCTFBPFLX-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)C |
| Storage condition | Store at 0-5°C |
|
~83%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: GLAXO GROUP LIMITED; ALVARO, Giuseppe; DECOR, Anne; FONTANA, Stefano; HAMPRECHT, Dieter; LARGE, Charles; MARASCO, Agostino Patent: WO2011/69951 A1, 2011 ; Location in patent: Page/Page column 77 ; WO 2011/069951 A1 |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 4 p. 1077 - 1079 |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: Tetrahedron, , vol. 53, # 4 p. 1275 - 1294 |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: Tetrahedron, , vol. 53, # 4 p. 1275 - 1294 |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: US2013/66109 A1, ; |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: Tetrahedron Asymmetry, , vol. 17, # 13 p. 1995 - 1999 |
|
~%
N-Boc-D-tert-leucine CAS#:124655-17-0 |
| Literature: US2013/66109 A1, ; |
| boc-d-tle-oh |
| D-Valine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- |
| (R)-Boc-tert-leucine |
| (R)-2-((tert-Butoxycarbonyl)amino)-3,3-dimethylbutanoic acid |
| MFCD00065575 |
| BOC-D-T-LEU |
| (R)-N-<(1,1-dimethylethoxy)carbonyl>-tert-leucine |
| (R)-2-(N-t-butoxycarbonylamino)-3,3-dimethylbutanoic acid |
| (R)-2-(Boc-amino)-3,3-dimethylbutyric Acid |
| (r)-n-(tert-butoxycarbonyl)-tert-leucine |
| N-(tert-Butoxycarbonyl)-3-methyl-D-valine |
| N-(tert-Butoxycarbonyl)-3-methyl-L-valine |
| N-Boc-D-tert-leucine |
| (R)-2-(tert-Butoxycarbonylamino)-3,3-dimethylbutyric Acid |
| (R)-2-(tert-butoxycarbonylamino)-3,3-dimethylbutanoic acid |
| L-Valine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- |
| N-(tert-Butoxycarbonyl)-D-tert-leucine |
| 3-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-valine |
| N-{[(1,1-dimethylethyl)oxy]carbonyl}-3-methyl-D-valine |
| 3-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-valine |
| boc-d-tert-leucine |
| (R)-2-tert-butoxycarbonylamino-3,3-dimethylbutyric acid |
| boc-tbu-d-gly-oh |