Propargyl-PEG4-C2-acid structure
|
Common Name | Propargyl-PEG4-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 1245823-51-1 | Molecular Weight | 304.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Propargyl-PEG4-C2-acidPropargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3[1]. |
| Name | Acetylene-PEG5-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG5-acid is a non-cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG5-acid can used to synthesize ADC inhibitors of Galectin-3[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C14H24O7 |
|---|---|
| Molecular Weight | 304.33600 |
| Exact Mass | 304.15200 |
| PSA | 83.45000 |
| LogP | 0.17730 |
| InChIKey | GWIACWQVTBMVEI-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 3-(2-{2-[2-(2-prop-2-ynyloxyethoxy)ethoxy]ethoxy}ethoxy)propanoic acid |
| Alkyne-PEG5-acid |
| PROPARGYL-PEG5-ACID |