3,5-bis(acetoxyacetylamino)-4-chlorobenzonitrile structure
|
Common Name | 3,5-bis(acetoxyacetylamino)-4-chlorobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 123548-56-1 | Molecular Weight | 367.74100 | |
| Density | 1.43g/cm3 | Boiling Point | 588.3ºC at 760mmHg | |
| Molecular Formula | C15H14ClN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.6ºC | |
Use of 3,5-bis(acetoxyacetylamino)-4-chlorobenzonitrileAcreozast (TYB-2285) is a histamine release inhibitor. Acreozast inhibits the histamine release primed with IL-3. Acreozast might regulate allergic inflammation in vivo by the suppression of mediator release primed with IL-3[1]. |
| Name | [2-[3-[(2-acetyloxyacetyl)amino]-2-chloro-5-cyanoanilino]-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Acreozast (TYB-2285) is a histamine release inhibitor. Acreozast inhibits the histamine release primed with IL-3. Acreozast might regulate allergic inflammation in vivo by the suppression of mediator release primed with IL-3[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 588.3ºC at 760mmHg |
| Molecular Formula | C15H14ClN3O6 |
| Molecular Weight | 367.74100 |
| Flash Point | 309.6ºC |
| Exact Mass | 367.05700 |
| PSA | 141.57000 |
| LogP | 2.51388 |
| Vapour Pressure | 8.03E-14mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | VNVBCWREJHKWSG-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)Nc1cc(C#N)cc(NC(=O)COC(C)=O)c1Cl |
|
~29%
3,5-bis(acetoxy... CAS#:123548-56-1 |
| Literature: Ban, Masakazu; Taguchi, Hiroaki; Katsushima, Takeo; Takahashi, Mitsuru; Shinoda, Kiyotaka; Watanabe, Akihiko; Tominaga, Takanari Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 7 p. 1077 - 1087 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acreozast |
| Acreozst |
| Tyb-2285 |
| UNII-84DZ9RW4WK |