Rizatriptan-d6 (benzoate salt) structure
|
Common Name | Rizatriptan-d6 (benzoate salt) | ||
|---|---|---|---|---|
| CAS Number | 1216984-85-8 | Molecular Weight | 397.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19D6N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rizatriptan-d6 (benzoate salt)Rizatriptan-d6 benzoate (MK 462-d6) is the deuterium labeled Rizatriptan benzoate. Rizatriptan benzoate is a 5-HT1 agonist triptan drug for the treatment of migraine headaches[1][2]. |
| Name | benzoic acid,2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]-N,N-bis(trideuteriomethyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | Rizatriptan-d6 benzoate (MK 462-d6) is the deuterium labeled Rizatriptan benzoate. Rizatriptan benzoate is a 5-HT1 agonist triptan drug for the treatment of migraine headaches[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C22H19D6N5O2 |
|---|---|
| Molecular Weight | 397.50300 |
| Exact Mass | 397.23800 |
| PSA | 87.04000 |
| LogP | 3.29660 |
| InChIKey | JPRXYLQNJJVCMZ-TXHXQZCNSA-N |
| SMILES | CN(C)CCc1c[nH]c2ccc(Cn3cncn3)cc12.O=C(O)c1ccccc1 |
| N,N-(Dimethyl-d6)-5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indole-3-ethanamine Benzoate |
| Maxalt-d6 |
| [2H6]-Rizatriptan benzoate |
| MK-0462-d6 |
| Rizatriptan-d6 Benzoate |
| MK-462-d6 |