Bumetanide D5
Modify Date: 2025-08-25 01:46:23
Bumetanide D5 structure
|
Common Name | Bumetanide D5 | ||
|---|---|---|---|---|
| CAS Number | 1216739-35-3 | Molecular Weight | 369.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15D5N2O5S | Melting Point | 234-236 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bumetanide D5Bumetanide D5 is a deuterium labeled Bumetanide. Bumetanide is a selective Na+-K+-Cl- (NKCC1) inhibitor, weakly inhibits NKCC2, with IC50s of 0.68 and 4.0 μM for hNKCC1A and hNKCC2A, respectively[1]. |
| Name | 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bumetanide D5 is a deuterium labeled Bumetanide. Bumetanide is a selective Na+-K+-Cl- (NKCC1) inhibitor, weakly inhibits NKCC2, with IC50s of 0.68 and 4.0 μM for hNKCC1A and hNKCC2A, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 234-236 °C |
|---|---|
| Molecular Formula | C17H15D5N2O5S |
| Molecular Weight | 369.44700 |
| Exact Mass | 369.14100 |
| PSA | 127.10000 |
| LogP | 4.89060 |
| InChIKey | MAEIEVLCKWDQJH-UPKDRLQUSA-N |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| Hazard Codes | Xi |
|---|
| Fordiuran-d5 |
| [2H5]-Bumetanide |
| Bumex-d5 |
| Bufenox-d5 |
| Burinex-d5 |
| PF 1593-d5 |
| Lunetoron-d5 |
| Lixil-d5 |
| Bumetanide-d5 |