Scutebata B structure
|
Common Name | Scutebata B | ||
|---|---|---|---|---|
| CAS Number | 1207181-58-5 | Molecular Weight | 633.68 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 797.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C35H39NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 436.0±32.9 °C | |
Use of Scutebata BScutebata B (compound 4) is a neoclerodane diterpenoid iaolated from the whole plant of Scutellaria barbata. Scutebata B has cytotoxic activities with IC50 values of 10.27~28.48 μM[1]. |
| Name | Scutebata B |
|---|---|
| Synonym | More Synonyms |
| Description | Scutebata B (compound 4) is a neoclerodane diterpenoid iaolated from the whole plant of Scutellaria barbata. Scutebata B has cytotoxic activities with IC50 values of 10.27~28.48 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50 10.73 μM (LoVo cell), 18.96 μM (SMMC-7721 cell), 10.27 μM (MCF-7 cell), 28.48 μM (HCT-116 cell)[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 797.3±60.0 °C at 760 mmHg |
| Molecular Formula | C35H39NO10 |
| Molecular Weight | 633.68 |
| Flash Point | 436.0±32.9 °C |
| Exact Mass | 633.257385 |
| PSA | 158.55000 |
| LogP | 5.04 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | PMRCLNAMSQXGTL-FJYLMWHZSA-N |
| SMILES | CC(=O)OC(CC1=C(O)C(=O)OC1)C1(C)C2CCC=C(C)C2(C)C(OC(=O)c2cccnc2)C(OC(=O)c2ccccc2)C1(C)O |
| Hazard Codes | Xi |
|---|
| (1R,2S,3R,4S,4aS,8aR)-4-[(1S)-1-Acetoxy-2-(4-hydroxy-5-oxo-2,5-dihydro-3-furanyl)ethyl]-2-(benzoyloxy)-3-hydroxy-3,4,8,8a-tetramethyl-1,2,3,4,4a,5,6,8a-octahydro-1-naphthalenyl nicotinate |
| 3-Pyridinecarboxylic acid, (1R,2S,3R,4S,4aS,8aR)-4-[(1S)-1-(acetyloxy)-2-(2,5-dihydro-4-hydroxy-5-oxo-3-furanyl)ethyl]-2-(benzoyloxy)-1,2,3,4,4a,5,6,8a-octahydro-3-hydroxy-3,4,8,8a-tetramethyl-1-naphthalenyl ester |