BOC-ORN(2-CL-Z)-OH structure
|
Common Name | BOC-ORN(2-CL-Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 118554-00-0 | Molecular Weight | 400.854 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 600.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H25ClN2O6 | Melting Point | 114-118ºC | |
| MSDS | Chinese USA | Flash Point | 317.1±31.5 °C | |
| Name | Boc-Orn(2-Cl-Z)-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.7±55.0 °C at 760 mmHg |
| Melting Point | 114-118ºC |
| Molecular Formula | C18H25ClN2O6 |
| Molecular Weight | 400.854 |
| Flash Point | 317.1±31.5 °C |
| Exact Mass | 400.140106 |
| PSA | 113.96000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | QOWSQCSRXFQXKJ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCNC(=O)OCc1ccccc1Cl)C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| L-Ornithine, N-[[(2-chlorophenyl)methoxy]carbonyl]-N-[(1,1-dimethylethoxy)carbonyl]- |
| MFCD00076972 |
| Nalpha-Boc-Ndelta-(2-chlorobenzyloxycarbonyl)-L-ornithine |
| N-{[(2-Chlorobenzyl)oxy]carbonyl}-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-ornithine |
| (2S)-5-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| N-(tert-Butoxycarbonyl)-N-{[(2-chlorobenzyl)oxy]carbonyl}-L-ornithine |