H-Orn(2-Cl-Z)-OH structure
|
Common Name | H-Orn(2-Cl-Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 118553-99-4 | Molecular Weight | 300.738 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 516.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.3±30.1 °C | |
| Name | (2S)-2-amino-5-[(2-chlorophenyl)methoxycarbonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 516.7±50.0 °C at 760 mmHg |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.738 |
| Flash Point | 266.3±30.1 °C |
| Exact Mass | 300.087677 |
| PSA | 101.65000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | TWPRGWUUQAAZHW-NSHDSACASA-N |
| SMILES | NC(CCCNC(=O)OCc1ccccc1Cl)C(=O)O |
| Storage condition | Store at 0°C |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00235874 |
| T955 |
| AmbotzHAA6970 |
| N'-(2-Chlorobenzyloxycarbonyl)-L-ornithine |
| H-Orn(2-Cl-Z)-OH |
| L-Ornithine, N-[[(2-chlorophenyl)methoxy]carbonyl]- |
| N-{[(2-Chlorobenzyl)oxy]carbonyl}-L-ornithine |
| (S)-2-Amino-5-((((2-chlorobenzyl)oxy)carbonyl)amino)pentanoic acid |