Boc-L-phe(2-Cl)-OH structure
|
Common Name | Boc-L-phe(2-Cl)-OH | ||
|---|---|---|---|---|
| CAS Number | 500789-05-9 | Molecular Weight | 299.750 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5±27.3 °C | |
| Name | Boc-(R)-3-AMino-3-(2-chlorophenyl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.5±40.0 °C at 760 mmHg |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.750 |
| Flash Point | 227.5±27.3 °C |
| Exact Mass | 299.092438 |
| PSA | 75.63000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | JBKHFGREKMCWAU-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1ccccc1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D-Phenylalanine, 2-chloro-N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-L-phe(2-Cl)-OH |
| N-(tert-Butoxycarbonyl)-2-chlor-D-phenylalanin |
| Fmoc-2-Chloro-D-b-phenylalanine |
| (2R)-3-(2-Chlorophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| N-(tert-Butoxycarbonyl)-2-chloro-D-phenylalanine |
| 2-Chloro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine |