Sagittatoside A structure
|
Common Name | Sagittatoside A | ||
|---|---|---|---|---|
| CAS Number | 118525-35-2 | Molecular Weight | 676.662 | |
| Density | 1.6±0.0 g/cm3 | Boiling Point | 933.3±0.0 °C at 760 mmHg | |
| Molecular Formula | C33H40O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8±0.0 °C | |
Use of Sagittatoside ASagittatoside A is a natural compound isolated from traditional Chinese herb Yinyanghuo (Herba Epimdii). |
| Name | sagittatoside A |
|---|---|
| Synonym | More Synonyms |
| Description | Sagittatoside A is a natural compound isolated from traditional Chinese herb Yinyanghuo (Herba Epimdii). |
|---|---|
| Related Catalog |
| Density | 1.6±0.0 g/cm3 |
|---|---|
| Boiling Point | 933.3±0.0 °C at 760 mmHg |
| Molecular Formula | C33H40O15 |
| Molecular Weight | 676.662 |
| Flash Point | 295.8±0.0 °C |
| Exact Mass | 676.236694 |
| PSA | 238.20000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | COHHGQPQHHUMDG-CCSCTSAWSA-N |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(O)cc(O)c3c(=O)c2OC2OC(C)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)cc1 |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| sagittatoside A |
| 5,7-Dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4-oxo-4H-chromen-3-yl 6-deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranoside |
| 4H-1-Benzopyran-4-one, 3-[(6-deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)- |
| SagittatosideA |