SKI-II Hydrochloride structure
|
Common Name | SKI-II Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1177741-83-1 | Molecular Weight | 339.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SKI-II HydrochlorideSKI-II HCl is a substrate competitive, reversible, and highly specific inhibitor of sphingosine kinase. |
| Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12Cl2N2OS |
|---|---|
| Molecular Weight | 339.24000 |
| Exact Mass | 338.00500 |
| PSA | 73.39000 |
| LogP | 5.78770 |
| InChIKey | ZDRVLAOYDGQLFI-UHFFFAOYSA-N |
| SMILES | Cl.Oc1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| HMS3229O14 |
| Sphingosine Kinase Inhibitor |
| SK Inhibitor |