Propargyl-PEG5-CH2CO2-NHS
Modify Date: 2025-08-26 20:24:43
Propargyl-PEG5-CH2CO2-NHS structure
|
Common Name | Propargyl-PEG5-CH2CO2-NHS | ||
|---|---|---|---|---|
| CAS Number | 1161883-51-7 | Molecular Weight | 387.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Propargyl-PEG5-CH2CO2-NHSPropargyl-PEG4-O-C1-NHS ester (compound 8) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | Propargyl-PEG4-O-C1-NHS ester |
|---|
| Description | Propargyl-PEG4-O-C1-NHS ester (compound 8) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C17H25NO9 |
|---|---|
| Molecular Weight | 387.38 |
| InChIKey | BNRYRRHZTIDZOR-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCC(=O)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |