basmisanil structure
|
Common Name | basmisanil | ||
|---|---|---|---|---|
| CAS Number | 1159600-41-5 | Molecular Weight | 445.464 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 726.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H20FN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.2±32.9 °C | |
Use of basmisanilBasmisanil is a highly selective GABAAα5 negative allosteric modulator. |
| Name | basmisanil |
|---|---|
| Synonym | More Synonyms |
| Description | Basmisanil is a highly selective GABAAα5 negative allosteric modulator. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 726.6±60.0 °C at 760 mmHg |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.464 |
| Flash Point | 393.2±32.9 °C |
| Exact Mass | 445.110779 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | VCGRFBXVSFAGGA-UHFFFAOYSA-N |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1COc1ccc(C(=O)N2CCS(=O)(=O)CC2)cn1 |
| Storage condition | 2-8℃ |
| Methanone, (1,1-dioxido-4-thiomorpholinyl)[6-[[3-(4-fluorophenyl)-5-methyl-4-isoxazolyl]methoxy]-3-pyridinyl]- |
| (1,1-Dioxido-4-thiomorpholinyl)(6-{[3-(4-fluorphenyl)-5-methyl-1,2-oxazol-4-yl]methoxy}-3-pyridinyl)methanon |
| (1,1-Dioxido-4-thiomorpholinyl)(6-{[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy}-3-pyridinyl)methanone |
| UNII-788PET5SUA |
| RG1662 |
| basmisanil |
| (1,1-dioxo-1λ6-thiomorpholin-4-yl)(6-{[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4- yl]methoxy}pyridin-3-yl)methanone |
| basmisanilum |