Bromo-PEG3-phosphonic acid diethyl ester
Modify Date: 2025-08-28 17:30:46
Bromo-PEG3-phosphonic acid diethyl ester structure
|
Common Name | Bromo-PEG3-phosphonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1148026-98-5 | Molecular Weight | 377.209 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 426.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H26BrO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7±25.9 °C | |
Use of Bromo-PEG3-phosphonic acid diethyl esterBromo-PEG3-phosphonic acid diethyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Diethyl (2-{2-[2-(2-bromoethoxy)ethoxy]ethoxy}ethyl)phosphonate |
|---|---|
| Synonym | More Synonyms |
| Description | Bromo-PEG3-phosphonic acid diethyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.5±35.0 °C at 760 mmHg |
| Molecular Formula | C12H26BrO6P |
| Molecular Weight | 377.209 |
| Flash Point | 211.7±25.9 °C |
| Exact Mass | 376.065033 |
| LogP | -0.02 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | WDIGPIACFQMAGX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCOCCOCCOCCBr)OCC |
| Diethyl (2-{2-[2-(2-bromoethoxy)ethoxy]ethoxy}ethyl)phosphonate |
| Phosphonic acid, P-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethyl]-, diethyl ester |
| MFCD11982880 |