Clopidogrel thiolactone
Modify Date: 2025-08-27 12:57:32
Clopidogrel thiolactone structure
|
Common Name | Clopidogrel thiolactone | ||
|---|---|---|---|---|
| CAS Number | 1147350-75-1 | Molecular Weight | 337.821 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 488.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H16ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.0±28.7 °C | |
Use of Clopidogrel thiolactoneClopidogrel thiolactone is a P2Y12 receptor inhibitor, is a potent antiplatelet agent.Target: P2Y12Clopidogrel thiolactone is the metabolic intermediate resulting from the first oxidative activation of clopidogrel. |
| Name | methyl (2S)-2-(2-chlorophenyl)-2-(2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Clopidogrel thiolactone is a P2Y12 receptor inhibitor, is a potent antiplatelet agent.Target: P2Y12Clopidogrel thiolactone is the metabolic intermediate resulting from the first oxidative activation of clopidogrel. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.1±45.0 °C at 760 mmHg |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.821 |
| Flash Point | 249.0±28.7 °C |
| Exact Mass | 337.053955 |
| PSA | 71.91000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | JBSAZVIMJUOBNB-WUJWULDRSA-N |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCC2SC(=O)C=C2C1 |
| Storage condition | 2-8℃ |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-methyl 2-(2-chlorophenyl)-2-(2-oxo-7,7a-dihydrothieno-[3,2-c]pyridin-5(2H,4H,6H)-yl)acetate |
| (2S)-Methyl 2-(2-chlorophenyl)-2-(2-oxo-7,7a-dihydrothieno[3,2-c]pyridin-5(2H,4H,6H)-yl)acetate |
| (2'S)-2-oxo-clopidogrel |
| [8S]-2-oxo-clopidogrel |
| clopidogrel thiolactone |
| Methyl (2S)-(2-chlorophenyl)(2-oxo-2,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5(4H)-yl)acetate |
| (2S)-methyl 2-(2-oxo-7,7a-dihydrothieno[3,2-c]pyridin-5(2H,4H,6H)-yl)-2-(2-chlorophenyl)acetate |
| Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-2,6,7,7a-tetrahydro-2-oxo-, methyl ester, (αS)- |
| 2-Oxoclopidogrel |
| methyl (2'S)-2-(2-chlorophenyl)-2-(2,4,5,6,7,7a-hexahydrothieno[3,2-c]-5-pyridin-2-one)acetate |