Clopidogrel-MP endo derivative-13C,d3 structure
|
Common Name | Clopidogrel-MP endo derivative-13C,d3 | ||
|---|---|---|---|---|
| CAS Number | 1346597-76-9 | Molecular Weight | 508.006 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C2413CH23D3ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Clopidogrel-MP endo derivative-13C,d3Clopidogrel-MP endo derivative-13C,d3 is the deuterium and 13C labeled Clopidogrel-MP endo derivative[1]. |
| Name | {1-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-4-[(2-{3-[(13C,2H3)methyloxy]phenyl}-2-oxoethyl)sulfanyl]-1,2,5,6-tetrahydro-3-pyridinyl}acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Clopidogrel-MP endo derivative-13C,d3 is the deuterium and 13C labeled Clopidogrel-MP endo derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C2413CH23D3ClNO6S |
| Molecular Weight | 508.006 |
| Exact Mass | 507.139130 |
| Index of Refraction | 1.632 |
| InChIKey | BNGUEGYOTLVBPU-KQORAOOSSA-N |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCC(SCC(=O)c2cccc(OC)c2)=C(CC(=O)O)C1 |
| 1,3(2H)-Pyridinediacetic acid, α1-(2-chlorophenyl)-5,6-dihydro-4-[[2-[3-(methyl-13C-d3-oxy)phenyl]-2-oxoethyl]thio]-, 1-methyl ester |
| {1-[1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl]-4-[(2-{3-[(13C,2H3)methyloxy]phenyl}-2-oxoethyl)sulfanyl]-1,2,5,6-tetrahydro-3-pyridinyl}acetic acid |