U-54494A HYDROCHLORIDE structure
|
Common Name | U-54494A HYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 112465-94-8 | Molecular Weight | 391.76 | |
| Density | N/A | Boiling Point | 496.5ºC at 760 mmHg | |
| Molecular Formula | C18H25Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
Use of U-54494A HYDROCHLORIDEU-54494A is a benzamide derivative related to κ-opioid receptor agonists, U-54494A has an anticonvulsant activity[1]. |
| Name | 3,4-dichloro-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)benzamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | U-54494A is a benzamide derivative related to κ-opioid receptor agonists, U-54494A has an anticonvulsant activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 496.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H25Cl3N2O |
| Molecular Weight | 391.76 |
| Flash Point | 254.1ºC |
| Exact Mass | 390.10300 |
| PSA | 23.55000 |
| LogP | 5.21230 |
| Vapour Pressure | 5.38E-10mmHg at 25°C |
| InChIKey | WFUASZXAHZXJMX-PPPUBMIESA-N |
| SMILES | CN(C(=O)c1ccc(Cl)c(Cl)c1)C1CCCCC1N1CCCC1.Cl |
| Ochratoxin A |