3,6-dibromo-9-prop-2-ynylcarbazole structure
|
Common Name | 3,6-dibromo-9-prop-2-ynylcarbazole | ||
|---|---|---|---|---|
| CAS Number | 105729-54-2 | Molecular Weight | 363.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dibromo-9-prop-2-ynylcarbazole |
|---|
| Molecular Formula | C15H9Br2N |
|---|---|
| Molecular Weight | 363.04700 |
| Exact Mass | 360.91000 |
| PSA | 4.93000 |
| LogP | 4.95270 |
| InChIKey | QQIKLOBTAMDQGZ-UHFFFAOYSA-N |
| SMILES | C#CCn1c2ccc(Br)cc2c2cc(Br)ccc21 |
|
~98%
3,6-dibromo-9-p... CAS#:105729-54-2 |
| Literature: Karpov; Zavgorodnii; Denisov Russian Journal of Organic Chemistry, 2001 , vol. 37, # 12 p. 1731 - 1735 |
|
~%
3,6-dibromo-9-p... CAS#:105729-54-2 |
| Literature: Eckert, Hellmut; Yesinowski, James P.; Sandman, Daniel J.; Velazquez, Christopher S. Journal of the American Chemical Society, 1987 , vol. 109, # 3 p. 761 - 768 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |