3,6-dibromo-9-[6-(3,6-dibromocarbazol-9-yl)hexa-2,4-diynyl]carbazole structure
|
Common Name | 3,6-dibromo-9-[6-(3,6-dibromocarbazol-9-yl)hexa-2,4-diynyl]carbazole | ||
|---|---|---|---|---|
| CAS Number | 102036-44-2 | Molecular Weight | 724.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H16Br4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dibromo-9-[6-(3,6-dibromocarbazol-9-yl)hexa-2,4-diynyl]carbazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H16Br4N2 |
|---|---|
| Molecular Weight | 724.07700 |
| Exact Mass | 719.80500 |
| PSA | 9.86000 |
| LogP | 9.65940 |
| InChIKey | IKFYJRMKSKIJLE-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)c1cc(Br)ccc1n2CC#CC#CCn1c2ccc(Br)cc2c2cc(Br)ccc21 |
|
~73%
3,6-dibromo-9-[... CAS#:102036-44-2 |
| Literature: Journal of the American Chemical Society, , vol. 109, # 3 p. 761 - 768 |
|
~%
3,6-dibromo-9-[... CAS#:102036-44-2 |
| Literature: Journal of the American Chemical Society, , vol. 109, # 3 p. 761 - 768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9H-Carbazole,9,9'-(2,4-hexadiyne-1,6-diyl)bis[3,6-dibromo |
| bis(3',6'-dibromo-N-carbazolyl)-2,4-hexadiyne |