Spiroxatrine
Modify Date: 2025-08-25 17:18:17
Spiroxatrine structure
|
Common Name | Spiroxatrine | ||
|---|---|---|---|---|
| CAS Number | 1054-88-2 | Molecular Weight | 379.45 | |
| Density | 1.32g/cm3 | Boiling Point | 602.8ºC at 760mmHg | |
| Molecular Formula | C22H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.4ºC | |
Use of SpiroxatrineSpiroxatrine (R 5188) is a selective, dual antagonist of 5-HT1α and α2-adrenergic, with the Ki values of 3.94, 224000, 118.5 nM for 5-HT1α，5-HT1β and 5-HT2，respectively. Spiroxatrine (R 5188) has a sedative effect[1][2][3][4]. |
| Name | 8-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Spiroxatrine (R 5188) is a selective, dual antagonist of 5-HT1α and α2-adrenergic, with the Ki values of 3.94, 224000, 118.5 nM for 5-HT1α，5-HT1β and 5-HT2，respectively. Spiroxatrine (R 5188) has a sedative effect[1][2][3][4]. |
|---|---|
| Related Catalog | |
| Target |
α2-adrenergic receptor 5-HT1A Receptor:3.94 nM (Ki) 5-HT1B/D Receptor:224000 nM (Ki) 5-HT2 Receptor:118.5 nM (Ki) |
| References |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 602.8ºC at 760mmHg |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.45 |
| Flash Point | 318.4ºC |
| Exact Mass | 379.19000 |
| PSA | 54.04000 |
| LogP | 2.58660 |
| Vapour Pressure | 1.74E-14mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | JVGBTTIJPBFLTE-UHFFFAOYSA-N |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(CC1COc3ccccc3O1)CC2 |
| WGK Germany | 3 |
|---|
| L-803,087 trifluoroacetate |
| Espiroxatrina |
| MFCD00055134 |
| R 5188 |
| spiroxatriene |
| Spiroxatrinum |
| Spiroxatrine |