2-acetyloxy-2-phenylpropanoic acid structure
|
Common Name | 2-acetyloxy-2-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 10487-92-0 | Molecular Weight | 208.21100 | |
| Density | 1.219g/cm3 | Boiling Point | 328.7ºC at 760mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126ºC | |
| Name | 2-acetyloxy-2-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 328.7ºC at 760mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 126ºC |
| Exact Mass | 208.07400 |
| PSA | 63.60000 |
| LogP | 1.54950 |
| Vapour Pressure | 7.48E-05mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | VGQZYGWEUVFRJE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C)(C(=O)O)c1ccccc1 |
|
~%
2-acetyloxy-2-p... CAS#:10487-92-0 |
| Literature: Mita, Tsuyoshi; Sugawara, Masumi; Hasegawa, Hiroyuki; Sato, Yoshihiro Journal of Organic Chemistry, 2012 , vol. 77, # 5 p. 2159 - 2168 |
|
~%
2-acetyloxy-2-p... CAS#:10487-92-0 |
| Literature: Barnes; Juliano Journal of the American Chemical Society, 1959 , vol. 81, p. 6462,6465 |
| d,l-O-Acetylatrolactinsaeure |
| 2-Acetoxy-2-phenyl-propionsaeure |
| 2-acetoxy-2-phenyl-propionic acid |
| dl-2-Phenyl-2-acetoxypropionsaeure |
| acetylatrolactic acid |