3-Acetoxy-2-phenylpropanoic Acid structure
|
Common Name | 3-Acetoxy-2-phenylpropanoic Acid | ||
|---|---|---|---|---|
| CAS Number | 14510-36-2 | Molecular Weight | 208.21100 | |
| Density | 1.22 g/cm3 | Boiling Point | 348.201ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.146ºC | |
| Name | 3-Acetoxy-2-phenylpropanoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22 g/cm3 |
|---|---|
| Boiling Point | 348.201ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 135.146ºC |
| Exact Mass | 208.07400 |
| PSA | 63.60000 |
| LogP | 1.41790 |
| InChIKey | OXGQBORIYFGJPM-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(C(=O)O)c1ccccc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetyloxy-2-phenylpropanoic acid |