cataCXium(R) FSulf structure
|
Common Name | cataCXium(R) FSulf | ||
|---|---|---|---|---|
| CAS Number | 1039775-34-2 | Molecular Weight | 738.86800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H43O10PS3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | dicyclohexyl-[2-sulfo-9-[3-(4-sulfophenyl)propyl]fluoren-9-yl]phosphanium,hydrogen sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H43O10PS3 |
|---|---|
| Molecular Weight | 738.86800 |
| Exact Mass | 738.17600 |
| PSA | 222.07000 |
| LogP | 11.16380 |
| InChIKey | HNJNDGZFLWQSEG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)O.O=S(=O)(O)c1ccc(CCCC2(P(C3CCCCC3)C3CCCCC3)c3ccccc3-c3ccc(S(=O)(=O)O)cc32)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Aqueous cross-coupling: highly efficient Suzuki-Miyaura coupling of N-heteroaryl halides and N-heteroarylboronic acids. Fleckenstein, C. A.; Plenio, H.
Green Chem. 9 , 1287, (2007)
|
| Dicyclohexyl-{2-sulfo-9-[3-(4-sulfo-phenyl)propyl]-9-fluorenyl}phosphonium-hydrogensulfate |
| dicyclohexyl {2-sulfo-9-[3-(4-sulfophenyl)propyl]-9H-fluoren-9-yl}phosphonium hydrogen sulfate |
| cataCXium FSulf |
| propphenfluPCy2DS*H2SO4 |
| cataCXium.(R). F sulf |