cataCXium(R) FPrPh,Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphine tetrafluoroborate
Modify Date: 2025-08-25 12:14:29
![cataCXium(R) FPrPh,Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphine tetrafluoroborate Structure](https://image.chemsrc.com/caspic/409/1007311-95-6.png)
cataCXium(R) FPrPh,Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphine tetrafluoroborate structure
|
Common Name | cataCXium(R) FPrPh,Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphine tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1007311-95-6 | Molecular Weight | 567.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H41BF4P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | dicyclohexyl-[9-(3-phenylpropyl)fluoren-9-yl]phosphanium,tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H41BF4P |
|---|---|
| Molecular Weight | 567.46800 |
| Exact Mass | 567.29800 |
| PSA | 13.59000 |
| LogP | 11.38080 |
| Appearance of Characters | Powder | white |
| InChIKey | VBCMIQSEFSKZNU-UHFFFAOYSA-O |
| SMILES | F[B-](F)(F)F.c1ccc(CCCC2([PH+](C3CCCCC3)C3CCCCC3)c3ccccc3-c3ccccc32)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Highly efficient Suzuki-Miyaura coupling of heterocyclic substrates through rational reaction design.
Chemistry 14 , 4267-4279, (2008) A dicyclohexyl(2-sulfo-9-(3-(4-sulfophenyl)propyl)-9H-fluoren-9-yl)phosphonium salt was synthesized in 64% overall yield in three steps from simple commercially available starting materials. The highl... |
|
|
Aqueous cross-coupling: highly efficient Suzuki-Miyaura coupling of N-heteroaryl halides and N-heteroarylboronic acids. Fleckenstein, C. A.; Plenio, H.
Green Chem. 9 , 1287, (2007)
|
|
|
C. A. Fleckenstein, et al.,
Org. Process Res. Dev. 12 , 475-479, (2008)
|
| Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphonium tetrafluoroborate |
| Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphine tetrafluoroborate |