N-(2-Methoxyphenyl)-2-(di-t-butylphosphino)pyrrole
Modify Date: 2025-08-21 16:25:52
N-(2-Methoxyphenyl)-2-(di-t-butylphosphino)pyrrole structure
|
Common Name | N-(2-Methoxyphenyl)-2-(di-t-butylphosphino)pyrrole | ||
|---|---|---|---|---|
| CAS Number | 1053658-91-5 | Molecular Weight | 317.40500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28NOP | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | ditert-butyl-[1-(2-methoxyphenyl)pyrrol-2-yl]phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H28NOP |
|---|---|
| Molecular Weight | 317.40500 |
| Exact Mass | 317.19100 |
| PSA | 27.75000 |
| LogP | 5.19010 |
| Appearance of Characters | Powder | white to yellowish |
| InChIKey | JALZQSOGOMZLEK-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-n1cccc1P(C(C)(C)C)C(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(Di-tert-butylphosphino)-1-(2-methoxyphenyl)-1H-pyrrole |
| CataCXium POMetB |
| 2-(di-tert-Butylphosphino)-1-(2-methoxyphenyl)-1H-pyrrole |
| N-(2-Methoxyphenyl)-2-(di-tert-butylphosphino)pyrrole |
| N-(2-Methoxyphenyl)-2-(di-t-butylphosphino)pyrrole |
| CATACXIUM(R) POMETB |