6-Maleimidocaproic acid sulfo-NHS
Modify Date: 2025-08-26 13:01:43
6-Maleimidocaproic acid sulfo-NHS structure
|
Common Name | 6-Maleimidocaproic acid sulfo-NHS | ||
|---|---|---|---|---|
| CAS Number | 103848-61-9 | Molecular Weight | 388.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6-Maleimidocaproic acid sulfo-NHS6-Maleimidocaproic acid sulfo-NHS is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Maleimidocaproic acid sulfo-NHS is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Molecular Formula | C14H16N2O9S |
|---|---|
| Molecular Weight | 388.35000 |
| Exact Mass | 388.05800 |
| PSA | 163.81000 |
| InChIKey | NWHAVGHJSKQCHH-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| 1H-Pyrrole-1-hexanoicacid,2,5-dihydro-2,5-dioxo-,2,5-dioxo-3-sulfo-1-pyrrolidinyl ester |
| BICL221 |