2,5-dimethyl-6-pyridin-4-yl-4H-1,4-thiazin-3-one structure
|
Common Name | 2,5-dimethyl-6-pyridin-4-yl-4H-1,4-thiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 103807-33-6 | Molecular Weight | 220.29100 | |
| Density | 1.189g/cm3 | Boiling Point | 459.1ºC at 760mmHg | |
| Molecular Formula | C11H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | 2,5-dimethyl-6-pyridin-4-yl-4H-1,4-thiazin-3-one |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760mmHg |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.29100 |
| Flash Point | 231.5ºC |
| Exact Mass | 220.06700 |
| PSA | 70.78000 |
| LogP | 2.29750 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | BASQBTAAMSCNOS-UHFFFAOYSA-N |
| SMILES | CC1=C(c2ccncc2)SC(C)C(=O)N1 |
|
~52%
2,5-dimethyl-6-... CAS#:103807-33-6 |
| Literature: Zenyaku Kogyo Kabushiki Kaisha Patent: US4800201 A1, 1989 ; |
|
~52%
2,5-dimethyl-6-... CAS#:103807-33-6 |
| Literature: Yamazaki; Harada; Matsuzaki; et al. Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2243 - 2253 |
|
~%
2,5-dimethyl-6-... CAS#:103807-33-6 |
| Literature: Yamazaki; Harada; Matsuzaki; et al. Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2243 - 2253 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |