5-methyl-6-quinolin-4-yl-4H-1,4-thiazin-3-one structure
|
Common Name | 5-methyl-6-quinolin-4-yl-4H-1,4-thiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 103807-23-4 | Molecular Weight | 256.32300 | |
| Density | 1.286g/cm3 | Boiling Point | 540.3ºC at 760mmHg | |
| Molecular Formula | C14H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.6ºC | |
| Name | 5-methyl-6-quinolin-4-yl-4H-1,4-thiazin-3-one |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 540.3ºC at 760mmHg |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.32300 |
| Flash Point | 280.6ºC |
| Exact Mass | 256.06700 |
| PSA | 70.78000 |
| LogP | 3.06220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | XVRPCJJFKURBNF-UHFFFAOYSA-N |
| SMILES | CC1=C(c2ccnc3ccccc23)SCC(=O)N1 |
|
~25%
5-methyl-6-quin... CAS#:103807-23-4 |
| Literature: Yamazaki; Harada; Matsuzaki; et al. Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2243 - 2253 |
|
~%
5-methyl-6-quin... CAS#:103807-23-4 |
| Literature: Yamazaki; Harada; Matsuzaki; et al. Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2243 - 2253 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |