Difelikefalin (CR845) structure
|
Common Name | Difelikefalin (CR845) | ||
|---|---|---|---|---|
| CAS Number | 1024828-77-0 | Molecular Weight | 679.84900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H53N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Difelikefalin (CR845)Difelikefalin (CR-845; FE-202845) is a peripherally restricted and selective agonist of kappa opioid receptor (KOR). Difelikefalin produces anti-inflammatory effects and has the potential in modulating pruritus in conditions such as chronic kidney disease[1][2]. |
| Name | Difelikefalin |
|---|---|
| Synonym | More Synonyms |
| Description | Difelikefalin (CR-845; FE-202845) is a peripherally restricted and selective agonist of kappa opioid receptor (KOR). Difelikefalin produces anti-inflammatory effects and has the potential in modulating pruritus in conditions such as chronic kidney disease[1][2]. |
|---|---|
| Related Catalog | |
| Target |
kappa opioid receptor (KOR)[1] |
| In Vitro | Difelikefalin (CR-845; FE-202845) does not penetrate the blood-brain barrier. Difelikefalin does not bind to mu opioid receptors or any other receptors beside KORs[1]. |
| References |
| Molecular Formula | C36H53N7O6 |
|---|---|
| Molecular Weight | 679.84900 |
| Exact Mass | 679.40600 |
| PSA | 222.97000 |
| LogP | 4.04460 |
| InChIKey | FWMNVWWHGCHHJJ-SKKKGAJSSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCCN)C(=O)N1CCC(N)(C(=O)O)CC1 |
| CR845 |
| FE-202845 |
| D-Phe-D-Phe-D-Leu-D-Lys-[γ-(4-N-piperidinyl)amino carboxylic acid] |
| 4-Piperidinecarboxylic acid, N1-(D-phenylalanyl-D-phenylalanyl-D-leucyl-D-lysyl)-4-amino- |
| N1-(D-Phenylalanyl-D-phenylalanyl-D-leucyl-D-lysyl)-4-amino-4-piperidinecarboxylic acid |
| 1-(D-phenylalanyl-D-phenylalanyl-D-leucyl-D-lysyl)-4-aminopiperidine-4-carboxylic acid |