Pseudoprotodioscin structure
|
Common Name | Pseudoprotodioscin | ||
|---|---|---|---|---|
| CAS Number | 102115-79-7 | Molecular Weight | 1031.184 | |
| Density | 1.45 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H82O21 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PseudoprotodioscinPseudoprotodioscin, a furostanoside, inhibits SREBP1/2 and microRNA 33a/b levels and reduces the gene expression regarding the synthesis of cholesterol and triglycerides[1]. |
| Name | protogracellin |
|---|---|
| Synonym | More Synonyms |
| Description | Pseudoprotodioscin, a furostanoside, inhibits SREBP1/2 and microRNA 33a/b levels and reduces the gene expression regarding the synthesis of cholesterol and triglycerides[1]. |
|---|---|
| Related Catalog | |
| In Vitro | In Hep G2 cells, Pseudoprotodioscin increases ABCA1 protein and mRNA levels, and promotes the effluxion of ApoA-1-mediated cholesterol. Pseudoprotodioscin inhibits SREBP1c and SREBP2 transcription by decreasing microRNA 33a/b levels. This procedure reciprocally lead to the increase of ABCA1 levels. In THP-1 macrophages, Pseudoprotodioscin shows the similar effect, which reduces HMGCR, FAS and ACC mRNA levels and promotes low density lipoprotein receptor by decreasing the PCSK9 levels[1]. |
| References |
| Density | 1.45 g/cm3 |
|---|---|
| Molecular Formula | C51H82O21 |
| Molecular Weight | 1031.184 |
| Exact Mass | 1030.534912 |
| PSA | 325.83000 |
| LogP | 5.31 |
| Index of Refraction | 1.631 |
| InChIKey | MDCUMTGKKLOMCW-VZFURQGKSA-N |
| SMILES | CC1=C(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CC=C5CC(OC6OC(CO)C(OC7OC(C)C(O)C(O)C7O)C(O)C6OC6OC(C)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C12 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 29389090 |
| PSEUDOPROTOTRIBESTIN |
| β-D-Glucopyranoside, (25R)-3-[[O-6-deoxy-α-L-mannopyranosyl-(1->2)-O-[6-deoxy-α-L-mannopyranosyl-(1->4)]-β-D-glucopyranosyl]oxy]furosta-5,20(22)-dien-27-yl |
| (3β,25R)-26-(β-D-Glucopyranosyloxy)furosta-5,20(22)-dien-3-yl 6-deoxy-α-L-mannopyranosyl-(1->;2)-[6-deoxy-α-L-mannopyranosyl-(1->;4)]-β-D-glucopyranoside |
| pseudo-Protodioscin |
| PROTODIOSCIN,PSEUDO |
| β-D-Glucopyranoside, (25R)-26-(β-D-glucopyranosyloxy)furosta-5,20(22)-dien-3-yl O-6-deoxy-α-L-mannopyranosyl-(1->2)-O-[6-deoxy-α-L-mannopyranosyl-(1->4)]- |
| (25R)-26-(β-D-Glucopyranosyloxy)furosta-5,20(22)-dien-3-yl 6-deoxy-α-L-mannopyranosyl-(1->2)-[6-deoxy-α-L-mannopyranosyl-(1->4)]-β-D-glucopyranoside |
| Pseduoprotodioscin |
| (25R)-3-{[6-Deoxy-α-L-mannopyranosyl-(1->2)-[6-deoxy-α-L-mannopyranosyl-(1->4)]-β-D-glucopyranosyl]oxy}furosta-5,20(22)-dien-27-yl β-D-glucopyranoside |
| β-D-Glucopyranoside, (3β,25R)-26-(β-D-glucopyranosyloxy)furosta-5,20(22)-dien-3-yl O-6-deoxy-α-L-mannopyranosyl-(1->2)-O-[6-deoxy-α-L-mannopyranosyl-(1->4)]- |
| Pseudoprotodioscin |