Protosappanin B structure
|
Common Name | Protosappanin B | ||
|---|---|---|---|---|
| CAS Number | 102036-29-3 | Molecular Weight | 304.29 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 655.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.2±31.5 °C | |
Use of Protosappanin BProtosappanin B is a phenolic compound extracted from Lignum Sappan. Anti-cancer activity[1]. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells[2]. |
| Name | Protosappanin B |
|---|---|
| Synonym | More Synonyms |
| Description | Protosappanin B is a phenolic compound extracted from Lignum Sappan. Anti-cancer activity[1]. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells[2]. |
|---|---|
| Related Catalog | |
| Target |
Apoptosis[2] |
| In Vitro | Protosappanin B (12.5, 25, 50, 100, 200 µg/mL, 48 hours) dose-dependently inhibits tumor cells, with IC50s of 21.32 µg/mL, 26.73 µg/mL, and 76.53 µg/mL for SW-480, HCT-116, and BTT cells, respectively[1]. Cell Viability Assay[1] Cell Line: CT-116, SW-480, and BTT Cells Concentration: 12.5, 25, 50, 100, 200 µg/mL Incubation Time: 48 hours Result: Dose-dependently inhibited tumor cells after 48 hours of treatment. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 655.5±55.0 °C at 760 mmHg |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.29 |
| Flash Point | 350.2±31.5 °C |
| Exact Mass | 304.094696 |
| PSA | 110.38000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | QRTYTQTVJQUCEP-UHFFFAOYSA-N |
| SMILES | OCC1(O)COc2cc(O)ccc2-c2cc(O)c(O)cc2C1 |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|
|
~%
Protosappanin B CAS#:102036-29-3 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 38, # 6 p. 1490 - 1494 |
|
~%
Protosappanin B CAS#:102036-29-3 |
| Literature: Chemical & Pharmaceutical Bulletin, , vol. 35, # 7 p. 3002 - 3005 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (7S)-7-(Hydroxymethyl)-7,8-dihydro-6H-dibenzo[b,d]oxocine-3,7,10,11-tetrol |
| 6H-Dibenz[b,d]oxocin-3,7,10,11-tetrol, 7,8-dihydro-7-(hydroxymethyl)-, (7S)- |