WAY-382510
Modify Date: 2025-11-26 16:24:48
WAY-382510 structure
|
Common Name | WAY-382510 | ||
|---|---|---|---|---|
| CAS Number | 1008385-75-8 | Molecular Weight | 280.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-382510antiepileptic agents; anticonvulsant activity; anticonvulsant, antibacterial, antifungal, antiviral, anticancer, and cytotoxic properties.; anti-lung and anti-breast cancer activity; cytotoxic agents; |
| Name | WAY-382510 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O3 |
|---|---|
| Molecular Weight | 280.28 |
| InChIKey | IMGOBPRWCTWDJB-UHFFFAOYSA-N |
| SMILES | CCC1CSC(Nc2ccc(-c3cc(-c4ccccc4)c4ccccc4n3)cc2)=N1 |
| 2-Thiazolamine, 4-ethyl-4,5-dihydro-N-[4-(4-phenyl-2-quinolinyl)phenyl]- |