Ald-Ph-amido-PEG3-C1-Boc structure
|
Common Name | Ald-Ph-amido-PEG3-C1-Boc | ||
|---|---|---|---|---|
| CAS Number | 1007215-94-2 | Molecular Weight | 395.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ald-Ph-amido-PEG3-C1-BocAld-Ph-amido-PEG3-C1-Boc is an ADC linker, which belongs to a polyethylene glycol (PEG) linker. |
| Name | Ald-Ph-amido-PEG3-C1-Boc |
|---|
| Description | Ald-Ph-amido-PEG3-C1-Boc is an ADC linker, which belongs to a polyethylene glycol (PEG) linker. |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Molecular Formula | C20H29NO7 |
|---|---|
| Molecular Weight | 395.45 |
| InChIKey | CNGPUCODLPWDJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCNC(=O)c1ccc(C=O)cc1 |