Ald-Ph-amido-PEG3-C-COOH
Modify Date: 2025-08-27 16:48:25
Ald-Ph-amido-PEG3-C-COOH structure
|
Common Name | Ald-Ph-amido-PEG3-C-COOH | ||
|---|---|---|---|---|
| CAS Number | 1007215-91-9 | Molecular Weight | 339.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ald-Ph-amido-PEG3-C-COOHAld-Ph-amido-PEG3-C-COOH is a noncleavable linker used for the antibody-drug conjugate (ADC). |
| Name | Ald-Ph-amido-PEG3-C-COOH |
|---|
| Description | Ald-Ph-amido-PEG3-C-COOH is a noncleavable linker used for the antibody-drug conjugate (ADC). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Molecular Formula | C16H21NO7 |
|---|---|
| Molecular Weight | 339.34 |
| InChIKey | GXMVWAHTNKJYAK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C(=O)NCCOCCOCCOCC(=O)O)cc1 |