Rosiridin structure
|
Common Name | Rosiridin | ||
|---|---|---|---|---|
| CAS Number | 100462-37-1 | Molecular Weight | 332.389 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 563.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.6±30.1 °C | |
Use of RosiridinRosiridin, which is isolated from Rhodiola rosea L., inhibits MAO A and MAO B with potential beneficial effect in depression and senile dementia. Rosiridin shows an inhibition of 83.8% against MAO B at 10 μM (pIC50=5.38)[1]. |
| Name | (2R,3R,4S,5S,6R)-2-[(2E)-4-hydroxy-3,7-dimethylocta-2,6-dienoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Rosiridin, which is isolated from Rhodiola rosea L., inhibits MAO A and MAO B with potential beneficial effect in depression and senile dementia. Rosiridin shows an inhibition of 83.8% against MAO B at 10 μM (pIC50=5.38)[1]. |
|---|---|
| Related Catalog | |
| Target |
pIC50: 5.38 (MAO B)[1] |
| In Vitro | Rosiridin presents an inhibition 16.2±2.3 and 83.8±1.1% on MAO A and MAO B at a concentration of 10 μM[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 563.5±50.0 °C at 760 mmHg |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.389 |
| Flash Point | 294.6±30.1 °C |
| Exact Mass | 332.183502 |
| PSA | 119.61000 |
| LogP | -0.11 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | PBPYEEMQIFDGSQ-RCZWDNKTSA-N |
| SMILES | CC(C)=CCC(O)C(C)=CCOC1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8℃ |
|
~95%
Rosiridin CAS#:100462-37-1 |
| Literature: Schoettner, Elisabeth; Simon, Kristina; Friedel, Manuel; Jones, Peter G.; Lindel, Thomas Tetrahedron Letters, 2008 , vol. 49, # 39 p. 5580 - 5582 |
| Rosiridin |
| (2E)-4-Hydroxy-3,7-dimethyl-2,6-octadien-1-yl β-D-glucopyranoside |
| X1221 |
| (2E,4S)-4-Hydroxy-3,7-dimethyl-2,6-octadien-1-yl beta-D-glucopyranoside |
| β-D-Glucopyranoside, (2E)-4-hydroxy-3,7-dimethyl-2,6-octadien-1-yl |