N-[2-(3-nitropyridin-4-yl)sulfanylphenyl]formamide structure
|
Common Name | N-[2-(3-nitropyridin-4-yl)sulfanylphenyl]formamide | ||
|---|---|---|---|---|
| CAS Number | 99970-59-9 | Molecular Weight | 275.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(3-nitropyridin-4-yl)sulfanylphenyl]formamide |
|---|
| Molecular Formula | C12H9N3O3S |
|---|---|
| Molecular Weight | 275.28300 |
| Exact Mass | 275.03600 |
| PSA | 116.60000 |
| LogP | 3.88200 |
| InChIKey | WUFYDQWIWHOYEF-UHFFFAOYSA-N |
| SMILES | O=CNc1ccccc1Sc1ccncc1[N+](=O)[O-] |
|
~%
N-[2-(3-nitropy... CAS#:99970-59-9 |
| Literature: Saggiomo et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1906,1908 |
|
~%
N-[2-(3-nitropy... CAS#:99970-59-9 |
| Literature: Saggiomo et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1906,1908 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |