N,N-Dimethyl-2-(3-nitropyridin-4-yl)ethenamine structure
|
Common Name | N,N-Dimethyl-2-(3-nitropyridin-4-yl)ethenamine | ||
|---|---|---|---|---|
| CAS Number | 64679-69-2 | Molecular Weight | 193.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-Dimethyl-2-(3-nitropyridin-4-yl)ethenamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3O2 |
|---|---|
| Molecular Weight | 193.20300 |
| Exact Mass | 193.08500 |
| PSA | 61.95000 |
| LogP | 2.04530 |
| InChIKey | YYUSZTQRCCAPDJ-GQCTYLIASA-N |
| SMILES | CN(C)C=Cc1ccncc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
N,N-Dimethyl-2-... CAS#:64679-69-2 |
| Literature: Patel, Jay P.; Kuang, Ye-Hong; Chen, Zhe-Sheng; Korlipara, Vijaya L. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 21 p. 6495 - 6499 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (E)-N,N-Dimethyl-2-(3-nitro-4-pyridinyl)ethenamine |