Lerzeparib structure
|
Common Name | Lerzeparib | ||
|---|---|---|---|---|
| CAS Number | 2459693-01-5 | Molecular Weight | 365.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LerzeparibLerzeparib is an (ADP-ribose) polymerase (PARP) inhibitor, with antineoplastic activity[1]. |
| Name | Lerzeparib |
|---|
| Description | Lerzeparib is an (ADP-ribose) polymerase (PARP) inhibitor, with antineoplastic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H20FN3O2 |
|---|---|
| Molecular Weight | 365.40 |
| InChIKey | FBKICCXLQKLXAZ-OAQYLSRUSA-N |
| SMILES | CC1(c2ccc(-c3[nH]c4cc(F)cc5c4c3CONC5=O)cc2)CCCN1 |