Z-Phe-Arg-pNA structure
|
Common Name | Z-Phe-Arg-pNA | ||
|---|---|---|---|---|
| CAS Number | 117761-01-0 | Molecular Weight | 575.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H33N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Phe-Arg-pNAZ-Phe-Arg-pNA is a substrate of Cathepsin L[1]. |
| Name | Z-Phe-Arg-pNA |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Phe-Arg-pNA is a substrate of Cathepsin L[1]. |
|---|---|
| Related Catalog | |
| Target |
Cathepsin L[1] |
| References |
| Molecular Formula | C29H33N7O6 |
|---|---|
| Molecular Weight | 575.62 |
| Exact Mass | 575.24900 |
| PSA | 204.25000 |
| LogP | 5.38800 |
| InChIKey | SNRRZRWIWHSYLU-DQEYMECFSA-N |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Z-FR-pNA |
| benzyloxycarbonyl-Phe-Arg-p-nitroanilide |