dipentyl pentanedioate
Modify Date: 2025-11-25 10:06:35
dipentyl pentanedioate structure
|
Common Name | dipentyl pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 51238-95-0 | Molecular Weight | 272.38000 | |
| Density | 0.962g/cm3 | Boiling Point | 313.9ºC at 760mmHg | |
| Molecular Formula | C15H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | dipentyl pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 313.9ºC at 760mmHg |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38000 |
| Flash Point | 140.8ºC |
| Exact Mass | 272.19900 |
| PSA | 52.60000 |
| LogP | 3.62350 |
| Index of Refraction | 1.443 |
| InChIKey | MSICJOVDFUZPDG-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)CCCC(=O)OCCCCC |
|
~%
dipentyl pentan... CAS#:51238-95-0 |
| Literature: Cunningham et al. Industrial and Engineering Chemistry, 1956 , vol. 48, p. 465 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 257-076-5 |
| Dipentyl glutarate |
| Diamyl glutarate |
| glutaric acid dipentyl ester |
| Pentanedioic acid,1,5-dipentyl ester |
| Glutarsaeure-dipentylester |