didecyl pentanedioate
Modify Date: 2024-12-01 18:28:19
didecyl pentanedioate structure
|
Common Name | didecyl pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 3634-94-4 | Molecular Weight | 412.64600 | |
| Density | 0.92g/cm3 | Boiling Point | 431.3ºC at 760mmHg | |
| Molecular Formula | C25H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | didecyl pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 431.3ºC at 760mmHg |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.64600 |
| Flash Point | 193.6ºC |
| Exact Mass | 412.35500 |
| PSA | 52.60000 |
| LogP | 7.52450 |
| Index of Refraction | 1.454 |
| InChIKey | FFPZYKQFAKXVSW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)CCCC(=O)OCCCCCCCCCC |
| HS Code | 2917190090 |
|---|
|
~%
didecyl pentane... CAS#:3634-94-4 |
| Literature: Schlenk,W. Justus Liebigs Annalen der Chemie, 1969 , vol. 727, p. 1 - 9 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Pentanedioic acid,1,5-didecyl ester |
| Pentanedioic acid,didecyl ester |
| Didecyl-glutarat |
| Didecyl glutarate |
| Glutaric acid,didecyl ester |
| EINECS 222-856-6 |