didecyl butanedioate
Modify Date: 2025-08-25 08:01:07
didecyl butanedioate structure
|
Common Name | didecyl butanedioate | ||
|---|---|---|---|---|
| CAS Number | 10595-82-1 | Molecular Weight | 398.62000 | |
| Density | 0.923g/cm3 | Boiling Point | 420.4ºC at 760mmHg | |
| Molecular Formula | C24H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | didecyl butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.923g/cm3 |
|---|---|
| Boiling Point | 420.4ºC at 760mmHg |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.62000 |
| Flash Point | 188.6ºC |
| Exact Mass | 398.34000 |
| PSA | 52.60000 |
| LogP | 7.13440 |
| Vapour Pressure | 2.82E-07mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | AEVBUGHMKXBGBL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)CCC(=O)OCCCCCCCCCC |
| HS Code | 2917190090 |
|---|
|
~%
didecyl butanedioate CAS#:10595-82-1 |
| Literature: Delhomme, Clara; Goh, Serena L.M.; Kuehn, Fritz E.; Weuster-Botz, Dirk Journal of Molecular Catalysis B: Enzymatic, 2012 , vol. 80, p. 39 - 47 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Didecyl-succinat |
| Bernsteinsaeure-bis-decylester |
| Didecyl succinate |
| Decyl succinate |
| Butanedioic acid,1,4-didecyl ester |
| EINECS 234-209-5 |
| Butanedioic acid,didecyl ester |
| succinic acid bis-decyl ester |
| di-n-decyl succinate |