Shizukaol G
Modify Date: 2025-08-20 16:41:37
Shizukaol G structure
|
Common Name | Shizukaol G | ||
|---|---|---|---|---|
| CAS Number | 165171-11-9 | Molecular Weight | 748.769 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C40H44O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Shizukaol GShizukaol G is a dimeric sesquiterpene. Shizukaol G can be isolated from the roots of Chloranthus japonicus[1]. |
| Name | Methyl (2Z)-2-[(1S,9S,13Z,18S,19S,21R,22S,23S,26S,28R,29S,30R,33R,36R)-9,18,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Shizukaol G is a dimeric sesquiterpene. Shizukaol G can be isolated from the roots of Chloranthus japonicus[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C40H44O14 |
| Molecular Weight | 748.769 |
| Exact Mass | 748.273132 |
| LogP | -1.07 |
| Index of Refraction | 1.656 |
| InChIKey | VQIMOHFODDGHOJ-XEQPTWOZSA-N |
| SMILES | COC(=O)C(C)=C1C(=O)C(O)C2(C)C3=C(CC4C5(OC(=O)C6=C5CC5C(O)(COC(=O)C(C)=CCOC(=O)C(O)CC(=O)OC6)C6CC6C54C)C13)C1CC12 |
| Propanoic acid, 2-[(1aR,1bS,2R,4aR,4bS,8aR,9S,9aS,10aR,10bS,10cS,11bS,15Z,20S)-1a,1b,2,3,4a,6,8,8a,9,9a,10,10a,10b,10c,11,11b-hexadecahydro-2,9,20-trihydroxy-1b,10b,15-trimethyl-3,6,14,19,22-pentaoxo-9,7-(methanooxy[2]butenooxybutanooxymethano)cyclopropa[4,5]cyclopropa[4',5']cyclopent[1',2':7,8]acephenanthryleno[10a,10-b]furan-4(1H)-ylidene]-, methyl ester, (2Z)- |
| Methyl (2Z)-2-[(1S,9S,13Z,18S,19S,21R,22S,23S,26S,28R,29S,30R,33R,36R)-9,18,30-trihydroxy-14,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21 .022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate |