methyl N-hydroxy-3-nitrobenzenecarboximidate structure
|
Common Name | methyl N-hydroxy-3-nitrobenzenecarboximidate | ||
|---|---|---|---|---|
| CAS Number | 137711-45-6 | Molecular Weight | 196.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-hydroxy-3-nitrobenzenecarboximidate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O4 |
|---|---|
| Molecular Weight | 196.16000 |
| Exact Mass | 196.04800 |
| PSA | 87.64000 |
| LogP | 1.90020 |
| InChIKey | XFAUFGPUALGSHY-UHFFFAOYSA-N |
| SMILES | COC(=NO)c1cccc([N+](=O)[O-])c1 |
|
~63%
methyl N-hydrox... CAS#:137711-45-6 |
| Literature: Luk'yanov, O. A.; Pokhvisneva, G. V. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1991 , vol. 40, # 9.2 p. 1906 - 1908 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1991 , # 9 p. 2148 - 2150 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| methyl m-nitrobenzhydroximate |
| methyl N-hydroxy-3-nitrobenzenecarboximidoate |
| Benzenecarboximidic acid,N-hydroxy-3-nitro-,methyl ester |